C9H14N4S — CID 61145624
2-N-methyl-2-N-(thiolan-3-yl)pyrimidine-2,5-diamine (PubChem CID 61145624) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-N-methyl-2-N-(thiolan-3-yl)pyrimidine-2,5-diamine.
| Compound Name | 2-N-methyl-2-N-(thiolan-3-yl)pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 61145624 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-N-methyl-2-N-(thiolan-3-yl)pyrimidine-2,5-diamine |
| SMILES | CN(c1ncc(N)cn1)C1CCSC1 |
| InChI | InChI=1S/C9H14N4S/c1-13(8-2-3-14-6-8)9-11-4-7(10)5-12-9/h4-5,8H,2-3,6,10H2,1H3 |
| InChIKey | OLLJULYHODDYIQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |