C12H19N3S — CID 83122062
6-[(1S)-1-aminoethyl]-N-methyl-N-(thiolan-3-yl)pyridin-3-amine (PubChem CID 83122062) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 6-[(1S)-1-aminoethyl]-N-methyl-N-(thiolan-3-yl)pyridin-3-amine.
| Compound Name | 6-[(1S)-1-aminoethyl]-N-methyl-N-(thiolan-3-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 83122062 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 6-[(1S)-1-aminoethyl]-N-methyl-N-(thiolan-3-yl)pyridin-3-amine |
| SMILES | C[C@H](N)c1ccc(N(C)C2CCSC2)cn1 |
| InChI | InChI=1S/C12H19N3S/c1-9(13)12-4-3-10(7-14-12)15(2)11-5-6-16-8-11/h3-4,7,9,11H,5-6,8,13H2,1-2H3/t9-,11?/m0/s1 |
| InChIKey | OZNDJOPNGKVSKS-FTNKSUMCSA-N |
| XLogP | 2.04 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |