C9H15N3 — CID 83122052
6-[(1R)-1-aminoethyl]-N,N-dimethylpyridin-3-amine (PubChem CID 83122052) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 6-[(1R)-1-aminoethyl]-N,N-dimethylpyridin-3-amine.
| Compound Name | 6-[(1R)-1-aminoethyl]-N,N-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 83122052 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 6-[(1R)-1-aminoethyl]-N,N-dimethylpyridin-3-amine |
| SMILES | C[C@@H](N)c1ccc(N(C)C)cn1 |
| InChI | InChI=1S/C9H15N3/c1-7(10)9-5-4-8(6-11-9)12(2)3/h4-7H,10H2,1-3H3/t7-/m1/s1 |
| InChIKey | DDUNEXOZBMCPTP-SSDOTTSWSA-N |
| XLogP | 1.17 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |