C12H15NOS — CID 43296832
4-[methyl(thiolan-3-yl)amino]benzaldehyde (PubChem CID 43296832) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-[methyl(thiolan-3-yl)amino]benzaldehyde.
| Compound Name | 4-[methyl(thiolan-3-yl)amino]benzaldehyde |
|---|---|
| PubChem CID | 43296832 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-[methyl(thiolan-3-yl)amino]benzaldehyde |
| SMILES | CN(c1ccc(C=O)cc1)C1CCSC1 |
| InChI | InChI=1S/C12H15NOS/c1-13(12-6-7-15-9-12)11-4-2-10(8-14)3-5-11/h2-5,8,12H,6-7,9H2,1H3 |
| InChIKey | YLMCWSSFTGJECS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|