C16H20N2O3 — CID 65344470
ethyl 1-[(3-cyano-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 65344470) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is ethyl 1-[(3-cyano-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 1-[(3-cyano-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 65344470 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | ethyl 1-[(3-cyano-4-methoxyphenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCN1Cc1ccc(OC)c(C#N)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-3-21-16(19)14-5-4-8-18(14)11-12-6-7-15(20-2)13(9-12)10-17/h6-7,9,14H,3-5,8,11H2,1-2H3 |
| InChIKey | JUUUWOUDEOHPDV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |