C28H24N4O4S4 — CID 6534836
N-(4-ethoxyphenyl)-2-[1-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]benzimidazol-2-yl]sulfanylacetamide (PubChem CID 6534836) has the molecular formula C28H24N4O4S4 and a molecular weight of 608.79 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[1-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]benzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[1-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]benzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 6534836 |
| Molecular Formula | C28H24N4O4S4 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[1-[3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanoyl]benzimidazol-2-yl]sulfanylacetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3ccccc3n2C(=O)CCN2C(=O)/C(=C/c3cccs3)SC2=S)cc1 |
| InChI | InChI=1S/C28H24N4O4S4/c1-2-36-19-11-9-18(10-12-19)29-24(33)17-39-27-30-21-7-3-4-8-22(21)32(27)25(34)13-14-31-26(35)23(40-28(31)37)16-20-6-5-15-38-20/h3-12,15-16H,2,13-14,17H2,1H3,(H,29,33)/b23-16- |
| InChIKey | AJTITZMIQFDATL-KQWNVCNZSA-N |
| XLogP | 6.16 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|