C20H17N3O2S4 — CID 6517153
(5Z)-3-[3-(2-ethylsulfanylbenzimidazol-1-yl)-3-oxopropyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 6517153) has the molecular formula C20H17N3O2S4 and a molecular weight of 459.64 g/mol. Its IUPAC name is (5Z)-3-[3-(2-ethylsulfanylbenzimidazol-1-yl)-3-oxopropyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[3-(2-ethylsulfanylbenzimidazol-1-yl)-3-oxopropyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6517153 |
| Molecular Formula | C20H17N3O2S4 |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | (5Z)-3-[3-(2-ethylsulfanylbenzimidazol-1-yl)-3-oxopropyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | CCSc1nc2ccccc2n1C(=O)CCN1C(=O)/C(=C/c2cccs2)SC1=S |
| InChI | InChI=1S/C20H17N3O2S4/c1-2-27-19-21-14-7-3-4-8-15(14)23(19)17(24)9-10-22-18(25)16(29-20(22)26)12-13-6-5-11-28-13/h3-8,11-12H,2,9-10H2,1H3/b16-12- |
| InChIKey | JPTLEVUGUJCDBJ-VBKFSLOCSA-N |
| XLogP | 5.14 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|