C15H22N2O3 — CID 65350517
2-[3-[(6-amino-4-methylhexanoyl)amino]phenyl]acetic acid (PubChem CID 65350517) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[3-[(6-amino-4-methylhexanoyl)amino]phenyl]acetic acid.
| Compound Name | 2-[3-[(6-amino-4-methylhexanoyl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 65350517 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[3-[(6-amino-4-methylhexanoyl)amino]phenyl]acetic acid |
| SMILES | CC(CCN)CCC(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-11(7-8-16)5-6-14(18)17-13-4-2-3-12(9-13)10-15(19)20/h2-4,9,11H,5-8,10,16H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | SAOWMWWGVJOVFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |