C16H21N3O5 — CID 119352064
2-[3-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]phenyl]acetic acid (PubChem CID 119352064) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[3-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 119352064 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-[3-[[4-(2-acetamidoethylamino)-4-oxobutanoyl]amino]phenyl]acetic acid |
| SMILES | CC(=O)NCCNC(=O)CCC(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C16H21N3O5/c1-11(20)17-7-8-18-14(21)5-6-15(22)19-13-4-2-3-12(9-13)10-16(23)24/h2-4,9H,5-8,10H2,1H3,(H,17,20)(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | HCYIIUUGTKYQKD-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|