C30H39NO3 — CID 66690979
2-[3-(docosa-4,7,10,13,16,19-hexaenoylamino)phenyl]acetic acid (PubChem CID 66690979) has the molecular formula C30H39NO3 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[3-(docosa-4,7,10,13,16,19-hexaenoylamino)phenyl]acetic acid.
| Compound Name | 2-[3-(docosa-4,7,10,13,16,19-hexaenoylamino)phenyl]acetic acid |
|---|---|
| PubChem CID | 66690979 |
| Molecular Formula | C30H39NO3 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.29 |
| IUPAC Name | 2-[3-(docosa-4,7,10,13,16,19-hexaenoylamino)phenyl]acetic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)Nc1cccc(CC(=O)O)c1 |
| InChI | InChI=1S/C30H39NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-29(32)31-28-23-21-22-27(25-28)26-30(33)34/h3-4,6-7,9-10,12-13,15-16,18-19,21-23,25H,2,5,8,11,14,17,20,24,26H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | BSWZYWWBLJWRCB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|