C12H11F3O3 — CID 65350786
1,4-dioxan-2-yl-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 65350786) has the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | 1,4-dioxan-2-yl-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 65350786 |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 1,4-dioxan-2-yl-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)C1COCCO1 |
| InChI | InChI=1S/C12H11F3O3/c13-12(14,15)9-4-2-1-3-8(9)11(16)10-7-17-5-6-18-10/h1-4,10H,5-7H2 |
| InChIKey | SKHZXMPWKZLNNK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |