C10H12O4 — CID 130964889
1,4-dioxan-2-yl-(4-methylfuran-3-yl)methanone (PubChem CID 130964889) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1,4-dioxan-2-yl-(4-methylfuran-3-yl)methanone.
| Compound Name | 1,4-dioxan-2-yl-(4-methylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 130964889 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1,4-dioxan-2-yl-(4-methylfuran-3-yl)methanone |
| SMILES | Cc1cocc1C(=O)C1COCCO1 |
| InChI | InChI=1S/C10H12O4/c1-7-4-13-5-8(7)10(11)9-6-12-2-3-14-9/h4-5,9H,2-3,6H2,1H3 |
| InChIKey | JLUHBGGCWXMFDQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |