C9H12O4 — CID 102652763
2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methanone (PubChem CID 102652763) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methanone.
| Compound Name | 2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 102652763 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1=CCCO1)C1COCCO1 |
| InChI | InChI=1S/C9H12O4/c10-9(7-2-1-3-12-7)8-6-11-4-5-13-8/h2,8H,1,3-6H2 |
| InChIKey | DNKHJTPHPILHHK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |