C8H13NO2 — CID 102652411
4-amino-1-(2,3-dihydrofuran-5-yl)butan-1-one (PubChem CID 102652411) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-amino-1-(2,3-dihydrofuran-5-yl)butan-1-one.
| Compound Name | 4-amino-1-(2,3-dihydrofuran-5-yl)butan-1-one |
|---|---|
| PubChem CID | 102652411 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-amino-1-(2,3-dihydrofuran-5-yl)butan-1-one |
| SMILES | NCCCC(=O)C1=CCCO1 |
| InChI | InChI=1S/C8H13NO2/c9-5-1-3-7(10)8-4-2-6-11-8/h4H,1-3,5-6,9H2 |
| InChIKey | VJRUOQVGFMSENV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |