C13H20O3 — CID 106655930
cycloocten-1-yl(1,4-dioxan-2-yl)methanone (PubChem CID 106655930) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is cycloocten-1-yl(1,4-dioxan-2-yl)methanone.
| Compound Name | cycloocten-1-yl(1,4-dioxan-2-yl)methanone |
|---|---|
| PubChem CID | 106655930 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | cycloocten-1-yl(1,4-dioxan-2-yl)methanone |
| SMILES | O=C(C1=CCCCCCC1)C1COCCO1 |
| InChI | InChI=1S/C13H20O3/c14-13(12-10-15-8-9-16-12)11-6-4-2-1-3-5-7-11/h6,12H,1-5,7-10H2 |
| InChIKey | BOIRFWSYWMPUDO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |