C17H20O2 — CID 106651928
cyclohepten-1-yl(3,4-dihydro-2H-chromen-3-yl)methanone (PubChem CID 106651928) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is cyclohepten-1-yl(3,4-dihydro-2H-chromen-3-yl)methanone.
| Compound Name | cyclohepten-1-yl(3,4-dihydro-2H-chromen-3-yl)methanone |
|---|---|
| PubChem CID | 106651928 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | cyclohepten-1-yl(3,4-dihydro-2H-chromen-3-yl)methanone |
| SMILES | O=C(C1=CCCCCC1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H20O2/c18-17(13-7-3-1-2-4-8-13)15-11-14-9-5-6-10-16(14)19-12-15/h5-7,9-10,15H,1-4,8,11-12H2 |
| InChIKey | APDHXLRBQQLOMV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |