About cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone
cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone (PubChem CID 106651930) has the molecular formula C17H20O
and a molecular weight of 240.35 g/mol. Its IUPAC name is cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone.
Molecular Properties
| Compound Name | cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone |
| PubChem CID | 106651930 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone |
| SMILES | O=C(C1=CCCCCC1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H20O/c18-17(13-7-3-1-2-4-8-13)16-11-14-9-5-6-10-15(14)12-16/h5-7,9-10,16H,1-4,8,11-12H2 |
| InChIKey | ORRFJMBPMPELFC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone?
The IUPAC name of cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone (CID 106651930) is cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone.
What is the SMILES notation for cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone?
The canonical SMILES for cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone is O=C(C1=CCCCCC1)C1Cc2ccccc2C1.
What is the InChIKey of cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone?
The InChIKey is ORRFJMBPMPELFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O/c18-17(13-7-3-1-2-4-8-13)16-11-14-9-5-6-10-15(14)12-16/h5-7,9-10,16H,1-4,8,11-12H2.
What are the key properties of cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone?
cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone has a molecular weight of 240.35 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohepten-1-yl(2,3-dihydro-1H-inden-2-yl)methanone is sourced from PubChem (CID 106651930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).