C15H17NO — CID 106655584
cyclohexen-1-yl(2,3-dihydro-1H-indol-2-yl)methanone (PubChem CID 106655584) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is cyclohexen-1-yl(2,3-dihydro-1H-indol-2-yl)methanone.
| Compound Name | cyclohexen-1-yl(2,3-dihydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 106655584 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | cyclohexen-1-yl(2,3-dihydro-1H-indol-2-yl)methanone |
| SMILES | O=C(C1=CCCCC1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H17NO/c17-15(11-6-2-1-3-7-11)14-10-12-8-4-5-9-13(12)16-14/h4-6,8-9,14,16H,1-3,7,10H2 |
| InChIKey | IKJCAHJXLROACW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |