C15H14N2O2 — CID 65408944
(2-amino-3-pyridinyl)-(3,4-dihydro-2H-chromen-3-yl)methanone (PubChem CID 65408944) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2-amino-3-pyridinyl)-(3,4-dihydro-2H-chromen-3-yl)methanone.
| Compound Name | (2-amino-3-pyridinyl)-(3,4-dihydro-2H-chromen-3-yl)methanone |
|---|---|
| PubChem CID | 65408944 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (2-amino-3-pyridinyl)-(3,4-dihydro-2H-chromen-3-yl)methanone |
| SMILES | Nc1ncccc1C(=O)C1COc2ccccc2C1 |
| InChI | InChI=1S/C15H14N2O2/c16-15-12(5-3-7-17-15)14(18)11-8-10-4-1-2-6-13(10)19-9-11/h1-7,11H,8-9H2,(H2,16,17) |
| InChIKey | JFIRONPRAMABEF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |