C11H14O6 — CID 157475358
cyclohex-2-ene-1,4-dione;1,4-dioxane-2-carboxylic acid (PubChem CID 157475358) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is cyclohex-2-ene-1,4-dione;1,4-dioxane-2-carboxylic acid.
| Compound Name | cyclohex-2-ene-1,4-dione;1,4-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 157475358 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | cyclohex-2-ene-1,4-dione;1,4-dioxane-2-carboxylic acid |
| SMILES | O=C(O)C1COCCO1.O=C1C=CC(=O)CC1 |
| InChI | InChI=1S/C6H6O2.C5H8O4/c7-5-1-2-6(8)4-3-5;6-5(7)4-3-8-1-2-9-4/h1-2H,3-4H2;4H,1-3H2,(H,6,7) |
| InChIKey | BVNDQEQSEQJUHH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |