C9H17NO2 — CID 65352921
1-(1,4-dioxan-2-yl)pent-4-en-1-amine (PubChem CID 65352921) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)pent-4-en-1-amine.
| Compound Name | 1-(1,4-dioxan-2-yl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 65352921 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)pent-4-en-1-amine |
| SMILES | C=CCCC(N)C1COCCO1 |
| InChI | InChI=1S/C9H17NO2/c1-2-3-4-8(10)9-7-11-5-6-12-9/h2,8-9H,1,3-7,10H2 |
| InChIKey | HROIUEKSTJGGAK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|