C9H10N6O — CID 65356203
4-amino-N,N-bis(cyanomethyl)-1-methylpyrazole-5-carboxamide (PubChem CID 65356203) has the molecular formula C9H10N6O and a molecular weight of 218.22 g/mol. Its IUPAC name is 4-amino-N,N-bis(cyanomethyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N,N-bis(cyanomethyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65356203 |
| Molecular Formula | C9H10N6O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-amino-N,N-bis(cyanomethyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1ncc(N)c1C(=O)N(CC#N)CC#N |
| InChI | InChI=1S/C9H10N6O/c1-14-8(7(12)6-13-14)9(16)15(4-2-10)5-3-11/h6H,4-5,12H2,1H3 |
| InChIKey | XMXUEWUGWQWBAN-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|