C11H18N4O3 — CID 65359410
ethyl 2-[(4-amino-1-methylpyrazole-5-carbonyl)-ethylamino]acetate (PubChem CID 65359410) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is ethyl 2-[(4-amino-1-methylpyrazole-5-carbonyl)-ethylamino]acetate.
| Compound Name | ethyl 2-[(4-amino-1-methylpyrazole-5-carbonyl)-ethylamino]acetate |
|---|---|
| PubChem CID | 65359410 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | ethyl 2-[(4-amino-1-methylpyrazole-5-carbonyl)-ethylamino]acetate |
| SMILES | CCOC(=O)CN(CC)C(=O)c1c(N)cnn1C |
| InChI | InChI=1S/C11H18N4O3/c1-4-15(7-9(16)18-5-2)11(17)10-8(12)6-13-14(10)3/h6H,4-5,7,12H2,1-3H3 |
| InChIKey | DQNRTGNPBCLCPL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |