C13H14BrFN4O — CID 65358559
4-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylpyrazole-5-carboxamide (PubChem CID 65358559) has the molecular formula C13H14BrFN4O and a molecular weight of 341.18 g/mol. Its IUPAC name is 4-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65358559 |
| Molecular Formula | C13H14BrFN4O |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 4-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H14BrFN4O/c1-2-19-12(11(16)7-18-19)13(20)17-6-8-5-9(15)3-4-10(8)14/h3-5,7H,2,6,16H2,1H3,(H,17,20) |
| InChIKey | UUCGYHYAZADGLY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |