C11H10BrFN4O — CID 64524304
3-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 64524304) has the molecular formula C11H10BrFN4O and a molecular weight of 313.13 g/mol. Its IUPAC name is 3-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64524304 |
| Molecular Formula | C11H10BrFN4O |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3-amino-N-[(2-bromo-5-fluorophenyl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cc(C(=O)NCc2cc(F)ccc2Br)[nH]n1 |
| InChI | InChI=1S/C11H10BrFN4O/c12-8-2-1-7(13)3-6(8)5-15-11(18)9-4-10(14)17-16-9/h1-4H,5H2,(H,15,18)(H3,14,16,17) |
| InChIKey | QJOFKUUNCCVQLD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |