C21H16BrFN2O3 — CID 56548854
4-[4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]phenoxy]benzamide (PubChem CID 56548854) has the molecular formula C21H16BrFN2O3 and a molecular weight of 443.27 g/mol. Its IUPAC name is 4-[4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548854 |
| Molecular Formula | C21H16BrFN2O3 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NCc3cc(F)ccc3Br)cc2)cc1 |
| InChI | InChI=1S/C21H16BrFN2O3/c22-19-10-5-16(23)11-15(19)12-25-21(27)14-3-8-18(9-4-14)28-17-6-1-13(2-7-17)20(24)26/h1-11H,12H2,(H2,24,26)(H,25,27) |
| InChIKey | OTWURCOJWCACDE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |