C15H12BBrFNO4 — CID 166430834
[4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166430834) has the molecular formula C15H12BBrFNO4 and a molecular weight of 379.98 g/mol. Its IUPAC name is [4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166430834 |
| Molecular Formula | C15H12BBrFNO4 |
| Molecular Weight | 379.98 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | [4-[(2-bromo-5-fluorophenyl)methylcarbamoyl]-2-formylphenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)NCc2cc(F)ccc2Br)ccc1B(O)O |
| InChI | InChI=1S/C15H12BBrFNO4/c17-14-4-2-12(18)6-10(14)7-19-15(21)9-1-3-13(16(22)23)11(5-9)8-20/h1-6,8,22-23H,7H2,(H,19,21) |
| InChIKey | ONAGEJJTMAHMGF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.98 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|