C13H10BF3N2O5 — CID 166432437
[2-formyl-4-[[5-(trifluoromethyl)-1,3-oxazol-4-yl]methylcarbamoyl]phenyl]boronic acid (PubChem CID 166432437) has the molecular formula C13H10BF3N2O5 and a molecular weight of 342.04 g/mol. Its IUPAC name is [2-formyl-4-[[5-(trifluoromethyl)-1,3-oxazol-4-yl]methylcarbamoyl]phenyl]boronic acid.
| Compound Name | [2-formyl-4-[[5-(trifluoromethyl)-1,3-oxazol-4-yl]methylcarbamoyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166432437 |
| Molecular Formula | C13H10BF3N2O5 |
| Molecular Weight | 342.04 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | [2-formyl-4-[[5-(trifluoromethyl)-1,3-oxazol-4-yl]methylcarbamoyl]phenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)NCc2ncoc2C(F)(F)F)ccc1B(O)O |
| InChI | InChI=1S/C13H10BF3N2O5/c15-13(16,17)11-10(19-6-24-11)4-18-12(21)7-1-2-9(14(22)23)8(3-7)5-20/h1-3,5-6,22-23H,4H2,(H,18,21) |
| InChIKey | PHKIIGHADWZTGZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.04 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|