C16H14BFN2O4 — CID 166430782
[4-[[1-(5-fluoro-2-pyridinyl)cyclopropyl]carbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166430782) has the molecular formula C16H14BFN2O4 and a molecular weight of 328.11 g/mol. Its IUPAC name is [4-[[1-(5-fluoro-2-pyridinyl)cyclopropyl]carbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[[1-(5-fluoro-2-pyridinyl)cyclopropyl]carbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166430782 |
| Molecular Formula | C16H14BFN2O4 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | [4-[[1-(5-fluoro-2-pyridinyl)cyclopropyl]carbamoyl]-2-formylphenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)NC2(c3ccc(F)cn3)CC2)ccc1B(O)O |
| InChI | InChI=1S/C16H14BFN2O4/c18-12-2-4-14(19-8-12)16(5-6-16)20-15(22)10-1-3-13(17(23)24)11(7-10)9-21/h1-4,7-9,23-24H,5-6H2,(H,20,22) |
| InChIKey | ZROMEJLGGHIGIE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|