C14H24N4O2 — CID 65358828
4-amino-1-ethyl-N-[(1-hydroxycycloheptyl)methyl]pyrazole-5-carboxamide (PubChem CID 65358828) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-[(1-hydroxycycloheptyl)methyl]pyrazole-5-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-[(1-hydroxycycloheptyl)methyl]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65358828 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-amino-1-ethyl-N-[(1-hydroxycycloheptyl)methyl]pyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C14H24N4O2/c1-2-18-12(11(15)9-17-18)13(19)16-10-14(20)7-5-3-4-6-8-14/h9,20H,2-8,10,15H2,1H3,(H,16,19) |
| InChIKey | MLDUDASRBMHTIH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |