C14H17FN4O — CID 65359004
4-amino-N,1-diethyl-N-(3-fluorophenyl)pyrazole-5-carboxamide (PubChem CID 65359004) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-amino-N,1-diethyl-N-(3-fluorophenyl)pyrazole-5-carboxamide.
| Compound Name | 4-amino-N,1-diethyl-N-(3-fluorophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65359004 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-amino-N,1-diethyl-N-(3-fluorophenyl)pyrazole-5-carboxamide |
| SMILES | CCN(C(=O)c1c(N)cnn1CC)c1cccc(F)c1 |
| InChI | InChI=1S/C14H17FN4O/c1-3-18(11-7-5-6-10(15)8-11)14(20)13-12(16)9-17-19(13)4-2/h5-9H,3-4,16H2,1-2H3 |
| InChIKey | RAYDWBQXZLHDNZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |