C8H10N4S — CID 65362542
2-thiophen-3-yl-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 65362542) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-thiophen-3-yl-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | 2-thiophen-3-yl-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 65362542 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 2-thiophen-3-yl-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | NC(Cc1ccsc1)c1ncn[nH]1 |
| InChI | InChI=1S/C8H10N4S/c9-7(8-10-5-11-12-8)3-6-1-2-13-4-6/h1-2,4-5,7H,3,9H2,(H,10,11,12) |
| InChIKey | AUQWPUBDXBYRSM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |