C15H12ClN3O2 — CID 65365429
4-(6-chloropyridine-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 65365429) has the molecular formula C15H12ClN3O2 and a molecular weight of 301.73 g/mol. Its IUPAC name is 4-(6-chloropyridine-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-(6-chloropyridine-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 65365429 |
| Molecular Formula | C15H12ClN3O2 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 4-(6-chloropyridine-2-carbonyl)-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)c2cccc(Cl)n2)Cc2ccccc2N1 |
| InChI | InChI=1S/C15H12ClN3O2/c16-13-7-3-6-12(17-13)15(21)19-8-10-4-1-2-5-11(10)18-14(20)9-19/h1-7H,8-9H2,(H,18,20) |
| InChIKey | RATKJGIQHIJXPM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|