C10H10N2O3S2 — CID 65365705
4-(methoxymethylsulfanyl)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 65365705) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(methoxymethylsulfanyl)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-(methoxymethylsulfanyl)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 65365705 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-(methoxymethylsulfanyl)-5-methylthieno[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | COCSc1ncnc2sc(C(=O)O)c(C)c12 |
| InChI | InChI=1S/C10H10N2O3S2/c1-5-6-8(16-4-15-2)11-3-12-9(6)17-7(5)10(13)14/h3H,4H2,1-2H3,(H,13,14) |
| InChIKey | CNTNBJNKSDYJOP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|