About oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate
oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate (PubChem CID 65375309) has the molecular formula C13H15ClO6S
and a molecular weight of 334.78 g/mol. Its IUPAC name is oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate.
Molecular Properties
| Compound Name | oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate |
| PubChem CID | 65375309 |
| Molecular Formula | C13H15ClO6S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate |
| SMILES | COCc1ccc(C(=O)OC2CCOC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H15ClO6S/c1-18-7-10-3-2-9(6-12(10)21(14,16)17)13(15)20-11-4-5-19-8-11/h2-3,6,11H,4-5,7-8H2,1H3 |
| InChIKey | XBCXNWBOCJASMN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate?
The IUPAC name of oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate (CID 65375309) is oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate.
What is the SMILES notation for oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate?
The canonical SMILES for oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate is COCc1ccc(C(=O)OC2CCOC2)cc1S(=O)(=O)Cl.
What is the InChIKey of oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate?
The InChIKey is XBCXNWBOCJASMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO6S/c1-18-7-10-3-2-9(6-12(10)21(14,16)17)13(15)20-11-4-5-19-8-11/h2-3,6,11H,4-5,7-8H2,1H3.
What are the key properties of oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate?
oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate has a molecular weight of 334.78 g/mol, XLogP of 1.71, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 3-chlorosulfonyl-4-(methoxymethyl)benzoate is sourced from PubChem (CID 65375309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).