C16H15ClN2S — CID 65377930
1-(1-benzothiophen-3-yl)-N-(2-chlorophenyl)ethane-1,2-diamine (PubChem CID 65377930) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-(2-chlorophenyl)ethane-1,2-diamine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-(2-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65377930 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-(2-chlorophenyl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ccccc1Cl)c1csc2ccccc12 |
| InChI | InChI=1S/C16H15ClN2S/c17-13-6-2-3-7-14(13)19-15(9-18)12-10-20-16-8-4-1-5-11(12)16/h1-8,10,15,19H,9,18H2 |
| InChIKey | TVHCLLQDZFVDJJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |