C16H20N2 — CID 65379210
1-(2-methylphenyl)-N-(4-methylphenyl)ethane-1,2-diamine (PubChem CID 65379210) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(2-methylphenyl)-N-(4-methylphenyl)ethane-1,2-diamine.
| Compound Name | 1-(2-methylphenyl)-N-(4-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65379210 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(2-methylphenyl)-N-(4-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(NC(CN)c2ccccc2C)cc1 |
| InChI | InChI=1S/C16H20N2/c1-12-7-9-14(10-8-12)18-16(11-17)15-6-4-3-5-13(15)2/h3-10,16,18H,11,17H2,1-2H3 |
| InChIKey | NFZNPGUGTLTTNW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |