C13H26N2O — CID 65379536
N-cycloheptyl-1-(oxolan-3-yl)ethane-1,2-diamine (PubChem CID 65379536) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-cycloheptyl-1-(oxolan-3-yl)ethane-1,2-diamine.
| Compound Name | N-cycloheptyl-1-(oxolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65379536 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-cycloheptyl-1-(oxolan-3-yl)ethane-1,2-diamine |
| SMILES | NCC(NC1CCCCCC1)C1CCOC1 |
| InChI | InChI=1S/C13H26N2O/c14-9-13(11-7-8-16-10-11)15-12-5-3-1-2-4-6-12/h11-13,15H,1-10,14H2 |
| InChIKey | VRFFVDKFMFGBDQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |