C8H19N3O — CID 83010989
2-(2,2-dimethylhydrazinyl)-2-(oxolan-3-yl)ethanamine (PubChem CID 83010989) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-(2,2-dimethylhydrazinyl)-2-(oxolan-3-yl)ethanamine.
| Compound Name | 2-(2,2-dimethylhydrazinyl)-2-(oxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 83010989 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 2-(2,2-dimethylhydrazinyl)-2-(oxolan-3-yl)ethanamine |
| SMILES | CN(C)NC(CN)C1CCOC1 |
| InChI | InChI=1S/C8H19N3O/c1-11(2)10-8(5-9)7-3-4-12-6-7/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | OOPXNVSCEPTYPX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|