C12H26N2O — CID 16792709
1-(oxolan-3-yl)-N,N-dipropylethane-1,2-diamine (PubChem CID 16792709) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-N,N-dipropylethane-1,2-diamine.
| Compound Name | 1-(oxolan-3-yl)-N,N-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 16792709 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1-(oxolan-3-yl)-N,N-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)C(CN)C1CCOC1 |
| InChI | InChI=1S/C12H26N2O/c1-3-6-14(7-4-2)12(9-13)11-5-8-15-10-11/h11-12H,3-10,13H2,1-2H3 |
| InChIKey | MAVMBZITIPSSLZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |