C14H30N2O — CID 61377686
N,N-bis(2-methylpropyl)-1-(oxolan-3-yl)ethane-1,2-diamine (PubChem CID 61377686) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-1-(oxolan-3-yl)ethane-1,2-diamine.
| Compound Name | N,N-bis(2-methylpropyl)-1-(oxolan-3-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 61377686 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | N,N-bis(2-methylpropyl)-1-(oxolan-3-yl)ethane-1,2-diamine |
| SMILES | CC(C)CN(CC(C)C)C(CN)C1CCOC1 |
| InChI | InChI=1S/C14H30N2O/c1-11(2)8-16(9-12(3)4)14(7-15)13-5-6-17-10-13/h11-14H,5-10,15H2,1-4H3 |
| InChIKey | ISPWQMKRIYSFOS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |