C15H24N2O3S — CID 65379984
N-(2,3-dimethylbutyl)-4-ethyl-3-sulfamoylbenzamide (PubChem CID 65379984) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(2,3-dimethylbutyl)-4-ethyl-3-sulfamoylbenzamide.
| Compound Name | N-(2,3-dimethylbutyl)-4-ethyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65379984 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-(2,3-dimethylbutyl)-4-ethyl-3-sulfamoylbenzamide |
| SMILES | CCc1ccc(C(=O)NCC(C)C(C)C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H24N2O3S/c1-5-12-6-7-13(8-14(12)21(16,19)20)15(18)17-9-11(4)10(2)3/h6-8,10-11H,5,9H2,1-4H3,(H,17,18)(H2,16,19,20) |
| InChIKey | UCSDXTUCZIUVJD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |