C12H19BrN2O — CID 65384910
2-N-(4-bromophenyl)-4-methoxy-2-methylbutane-1,2-diamine (PubChem CID 65384910) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-N-(4-bromophenyl)-4-methoxy-2-methylbutane-1,2-diamine.
| Compound Name | 2-N-(4-bromophenyl)-4-methoxy-2-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 65384910 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-N-(4-bromophenyl)-4-methoxy-2-methylbutane-1,2-diamine |
| SMILES | COCCC(C)(CN)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H19BrN2O/c1-12(9-14,7-8-16-2)15-11-5-3-10(13)4-6-11/h3-6,15H,7-9,14H2,1-2H3 |
| InChIKey | UFYRISABAXMOAQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |