C13H18BrF3N2 — CID 116535351
2-N-(4-bromophenyl)-6,6,6-trifluoro-2-methylhexane-1,2-diamine (PubChem CID 116535351) has the molecular formula C13H18BrF3N2 and a molecular weight of 339.20 g/mol. Its IUPAC name is 2-N-(4-bromophenyl)-6,6,6-trifluoro-2-methylhexane-1,2-diamine.
| Compound Name | 2-N-(4-bromophenyl)-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 116535351 |
| Molecular Formula | C13H18BrF3N2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-N-(4-bromophenyl)-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
| SMILES | CC(CN)(CCCC(F)(F)F)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H18BrF3N2/c1-12(9-18,7-2-8-13(15,16)17)19-11-5-3-10(14)4-6-11/h3-6,19H,2,7-9,18H2,1H3 |
| InChIKey | BWYPETPEFJMVBQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |