C14H21F3N2 — CID 116535346
2-N-benzyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine (PubChem CID 116535346) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-N-benzyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine.
| Compound Name | 2-N-benzyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 116535346 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-N-benzyl-6,6,6-trifluoro-2-methylhexane-1,2-diamine |
| SMILES | CC(CN)(CCCC(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C14H21F3N2/c1-13(11-18,8-5-9-14(15,16)17)19-10-12-6-3-2-4-7-12/h2-4,6-7,19H,5,8-11,18H2,1H3 |
| InChIKey | DZXXTYXGNGFGRR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |