C14H21F3N2O — CID 116535345
6,6,6-trifluoro-2-N-(2-methoxyphenyl)-2-methylhexane-1,2-diamine (PubChem CID 116535345) has the molecular formula C14H21F3N2O and a molecular weight of 290.33 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-N-(2-methoxyphenyl)-2-methylhexane-1,2-diamine.
| Compound Name | 6,6,6-trifluoro-2-N-(2-methoxyphenyl)-2-methylhexane-1,2-diamine |
|---|---|
| PubChem CID | 116535345 |
| Molecular Formula | C14H21F3N2O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 6,6,6-trifluoro-2-N-(2-methoxyphenyl)-2-methylhexane-1,2-diamine |
| SMILES | COc1ccccc1NC(C)(CN)CCCC(F)(F)F |
| InChI | InChI=1S/C14H21F3N2O/c1-13(10-18,8-5-9-14(15,16)17)19-11-6-3-4-7-12(11)20-2/h3-4,6-7,19H,5,8-10,18H2,1-2H3 |
| InChIKey | YUMXPXBPMFNWCE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |