C15H22N2O3S — CID 65386146
5-(2,3-dimethylpiperidine-1-carbonyl)-2-methylbenzenesulfonamide (PubChem CID 65386146) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 5-(2,3-dimethylpiperidine-1-carbonyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-(2,3-dimethylpiperidine-1-carbonyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 65386146 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-(2,3-dimethylpiperidine-1-carbonyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCCC(C)C2C)cc1S(N)(=O)=O |
| InChI | InChI=1S/C15H22N2O3S/c1-10-5-4-8-17(12(10)3)15(18)13-7-6-11(2)14(9-13)21(16,19)20/h6-7,9-10,12H,4-5,8H2,1-3H3,(H2,16,19,20) |
| InChIKey | DZNBPNSXGWHZQO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |