C11H19N3O4S — CID 65388486
N-(2-ethoxyethyl)-N-ethyl-4-sulfamoyl-1H-pyrrole-2-carboxamide (PubChem CID 65388486) has the molecular formula C11H19N3O4S and a molecular weight of 289.36 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-4-sulfamoyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-4-sulfamoyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65388486 |
| Molecular Formula | C11H19N3O4S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-4-sulfamoyl-1H-pyrrole-2-carboxamide |
| SMILES | CCOCCN(CC)C(=O)c1cc(S(N)(=O)=O)c[nH]1 |
| InChI | InChI=1S/C11H19N3O4S/c1-3-14(5-6-18-4-2)11(15)10-7-9(8-13-10)19(12,16)17/h7-8,13H,3-6H2,1-2H3,(H2,12,16,17) |
| InChIKey | HGNJTSPPNDSWSC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|