C13H21NOS — CID 65391060
1-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 65391060) has the molecular formula C13H21NOS and a molecular weight of 239.38 g/mol. Its IUPAC name is 1-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 65391060 |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-[2-(4,4-dimethylcyclohexyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(C2CCC(C)(C)CC2)n1 |
| InChI | InChI=1S/C13H21NOS/c1-9(15)11-8-16-12(14-11)10-4-6-13(2,3)7-5-10/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | KWZVARPVMTYRPG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |