C16H22N4O2S — CID 6539190
1-[(3,4-dimethoxyphenyl)methyl]-3-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 6539190) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 6539190 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | COc1ccc(CNC(=S)NCCCn2ccnc2)cc1OC |
| InChI | InChI=1S/C16H22N4O2S/c1-21-14-5-4-13(10-15(14)22-2)11-19-16(23)18-6-3-8-20-9-7-17-12-20/h4-5,7,9-10,12H,3,6,8,11H2,1-2H3,(H2,18,19,23) |
| InChIKey | XYENOKGNKNXUGG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|